C18H17F2N3O2S — CID 133499860
4-[2-[(7,8-difluoro-2-methylquinolin-4-yl)amino]ethyl]benzenesulfonamide (PubChem CID 133499860) has the molecular formula C18H17F2N3O2S and a molecular weight of 377.42 g/mol. Its IUPAC name is 4-[2-[(7,8-difluoro-2-methylquinolin-4-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[(7,8-difluoro-2-methylquinolin-4-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 133499860 |
| Molecular Formula | C18H17F2N3O2S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 4-[2-[(7,8-difluoro-2-methylquinolin-4-yl)amino]ethyl]benzenesulfonamide |
| SMILES | Cc1cc(NCCc2ccc(S(N)(=O)=O)cc2)c2ccc(F)c(F)c2n1 |
| InChI | InChI=1S/C18H17F2N3O2S/c1-11-10-16(14-6-7-15(19)17(20)18(14)23-11)22-9-8-12-2-4-13(5-3-12)26(21,24)25/h2-7,10H,8-9H2,1H3,(H,22,23)(H2,21,24,25) |
| InChIKey | HKDXVXRFBJJZCV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |