C9H12O2S — CID 13351277
methyl 2-(4,5-dimethylthiophen-2-yl)acetate (PubChem CID 13351277) has the molecular formula C9H12O2S and a molecular weight of 184.26 g/mol. Its IUPAC name is methyl 2-(4,5-dimethylthiophen-2-yl)acetate.
| Compound Name | methyl 2-(4,5-dimethylthiophen-2-yl)acetate |
|---|---|
| PubChem CID | 13351277 |
| Molecular Formula | C9H12O2S |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | methyl 2-(4,5-dimethylthiophen-2-yl)acetate |
| SMILES | COC(=O)Cc1cc(C)c(C)s1 |
| InChI | InChI=1S/C9H12O2S/c1-6-4-8(12-7(6)2)5-9(10)11-3/h4H,5H2,1-3H3 |
| InChIKey | SFDBCAIRKSUCBO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |