About 2-hydroxyethyl N-[(4,5-dimethylthiophen-2-yl)methyl]carbamate
2-hydroxyethyl N-[(4,5-dimethylthiophen-2-yl)methyl]carbamate (PubChem CID 79348993) has the molecular formula C10H15NO3S
and a molecular weight of 229.30 g/mol. Its IUPAC name is 2-hydroxyethyl N-[(4,5-dimethylthiophen-2-yl)methyl]carbamate.
Analyze 2-hydroxyethyl N-[(4,5-dimethylthiophen-2-yl)methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl N-[(4,5-dimethylthiophen-2-yl)methyl]carbamate?
The IUPAC name of 2-hydroxyethyl N-[(4,5-dimethylthiophen-2-yl)methyl]carbamate (CID 79348993) is 2-hydroxyethyl N-[(4,5-dimethylthiophen-2-yl)methyl]carbamate.
What is the SMILES notation for 2-hydroxyethyl N-[(4,5-dimethylthiophen-2-yl)methyl]carbamate?
The canonical SMILES for 2-hydroxyethyl N-[(4,5-dimethylthiophen-2-yl)methyl]carbamate is Cc1cc(CNC(=O)OCCO)sc1C.
What is the InChIKey of 2-hydroxyethyl N-[(4,5-dimethylthiophen-2-yl)methyl]carbamate?
The InChIKey is VPDZRKQWEQYUSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3S/c1-7-5-9(15-8(7)2)6-11-10(13)14-4-3-12/h5,12H,3-4,6H2,1-2H3,(H,11,13).
What are the key properties of 2-hydroxyethyl N-[(4,5-dimethylthiophen-2-yl)methyl]carbamate?
2-hydroxyethyl N-[(4,5-dimethylthiophen-2-yl)methyl]carbamate has a molecular weight of 229.30 g/mol, XLogP of 1.58, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl N-[(4,5-dimethylthiophen-2-yl)methyl]carbamate is sourced from PubChem (CID 79348993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).