About 2-bromo-N-[(4,5-dimethylthiophen-2-yl)methyl]propanamide
2-bromo-N-[(4,5-dimethylthiophen-2-yl)methyl]propanamide (PubChem CID 107905367) has the molecular formula C10H14BrNOS
and a molecular weight of 276.20 g/mol. Its IUPAC name is 2-bromo-N-[(4,5-dimethylthiophen-2-yl)methyl]propanamide.
Molecular Properties
| Compound Name | 2-bromo-N-[(4,5-dimethylthiophen-2-yl)methyl]propanamide |
| PubChem CID | 107905367 |
| Molecular Formula | C10H14BrNOS |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | 2-bromo-N-[(4,5-dimethylthiophen-2-yl)methyl]propanamide |
| SMILES | Cc1cc(CNC(=O)C(C)Br)sc1C |
| InChI | InChI=1S/C10H14BrNOS/c1-6-4-9(14-8(6)3)5-12-10(13)7(2)11/h4,7H,5H2,1-3H3,(H,12,13) |
| InChIKey | KUWJVWWBBQNFOF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N-[(4,5-dimethylthiophen-2-yl)methyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-[(4,5-dimethylthiophen-2-yl)methyl]propanamide?
The IUPAC name of 2-bromo-N-[(4,5-dimethylthiophen-2-yl)methyl]propanamide (CID 107905367) is 2-bromo-N-[(4,5-dimethylthiophen-2-yl)methyl]propanamide.
What is the SMILES notation for 2-bromo-N-[(4,5-dimethylthiophen-2-yl)methyl]propanamide?
The canonical SMILES for 2-bromo-N-[(4,5-dimethylthiophen-2-yl)methyl]propanamide is Cc1cc(CNC(=O)C(C)Br)sc1C.
What is the InChIKey of 2-bromo-N-[(4,5-dimethylthiophen-2-yl)methyl]propanamide?
The InChIKey is KUWJVWWBBQNFOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BrNOS/c1-6-4-9(14-8(6)3)5-12-10(13)7(2)11/h4,7H,5H2,1-3H3,(H,12,13).
What are the key properties of 2-bromo-N-[(4,5-dimethylthiophen-2-yl)methyl]propanamide?
2-bromo-N-[(4,5-dimethylthiophen-2-yl)methyl]propanamide has a molecular weight of 276.20 g/mol, XLogP of 2.76, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-[(4,5-dimethylthiophen-2-yl)methyl]propanamide is sourced from PubChem (CID 107905367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).