C12H18N2O2S2 — CID 107769625
2-acetamido-N-[(4,5-dimethylthiophen-2-yl)methyl]-3-sulfanylpropanamide (PubChem CID 107769625) has the molecular formula C12H18N2O2S2 and a molecular weight of 286.42 g/mol. Its IUPAC name is 2-acetamido-N-[(4,5-dimethylthiophen-2-yl)methyl]-3-sulfanylpropanamide.
| Compound Name | 2-acetamido-N-[(4,5-dimethylthiophen-2-yl)methyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 107769625 |
| Molecular Formula | C12H18N2O2S2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-acetamido-N-[(4,5-dimethylthiophen-2-yl)methyl]-3-sulfanylpropanamide |
| SMILES | CC(=O)NC(CS)C(=O)NCc1cc(C)c(C)s1 |
| InChI | InChI=1S/C12H18N2O2S2/c1-7-4-10(18-8(7)2)5-13-12(16)11(6-17)14-9(3)15/h4,11,17H,5-6H2,1-3H3,(H,13,16)(H,14,15) |
| InChIKey | RVPULONEGZEZDJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|