C12H19N3O2S — CID 77061716
N-[(4,5-dimethylthiophen-2-yl)methyl]-2-(N'-hydroxycarbamimidoyl)butanamide (PubChem CID 77061716) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is N-[(4,5-dimethylthiophen-2-yl)methyl]-2-(N'-hydroxycarbamimidoyl)butanamide.
| Compound Name | N-[(4,5-dimethylthiophen-2-yl)methyl]-2-(N'-hydroxycarbamimidoyl)butanamide |
|---|---|
| PubChem CID | 77061716 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-[(4,5-dimethylthiophen-2-yl)methyl]-2-(N'-hydroxycarbamimidoyl)butanamide |
| SMILES | CCC(C(=O)NCc1cc(C)c(C)s1)C(N)=NO |
| InChI | InChI=1S/C12H19N3O2S/c1-4-10(11(13)15-17)12(16)14-6-9-5-7(2)8(3)18-9/h5,10,17H,4,6H2,1-3H3,(H2,13,15)(H,14,16) |
| InChIKey | XJYXEOINUWRGRY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|