About 2-hydroxyethyl N-[(5-chlorothiophen-2-yl)methyl]carbamate
2-hydroxyethyl N-[(5-chlorothiophen-2-yl)methyl]carbamate (PubChem CID 79348989) has the molecular formula C8H10ClNO3S
and a molecular weight of 235.69 g/mol. Its IUPAC name is 2-hydroxyethyl N-[(5-chlorothiophen-2-yl)methyl]carbamate.
Molecular Properties
| Compound Name | 2-hydroxyethyl N-[(5-chlorothiophen-2-yl)methyl]carbamate |
| PubChem CID | 79348989 |
| Molecular Formula | C8H10ClNO3S |
| Molecular Weight | 235.69 g/mol |
| Exact Mass | 235.01 |
| IUPAC Name | 2-hydroxyethyl N-[(5-chlorothiophen-2-yl)methyl]carbamate |
| SMILES | O=C(NCc1ccc(Cl)s1)OCCO |
| InChI | InChI=1S/C8H10ClNO3S/c9-7-2-1-6(14-7)5-10-8(12)13-4-3-11/h1-2,11H,3-5H2,(H,10,12) |
| InChIKey | XUSOKVHIYFVPAV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.69 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxyethyl N-[(5-chlorothiophen-2-yl)methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl N-[(5-chlorothiophen-2-yl)methyl]carbamate?
The IUPAC name of 2-hydroxyethyl N-[(5-chlorothiophen-2-yl)methyl]carbamate (CID 79348989) is 2-hydroxyethyl N-[(5-chlorothiophen-2-yl)methyl]carbamate.
What is the SMILES notation for 2-hydroxyethyl N-[(5-chlorothiophen-2-yl)methyl]carbamate?
The canonical SMILES for 2-hydroxyethyl N-[(5-chlorothiophen-2-yl)methyl]carbamate is O=C(NCc1ccc(Cl)s1)OCCO.
What is the InChIKey of 2-hydroxyethyl N-[(5-chlorothiophen-2-yl)methyl]carbamate?
The InChIKey is XUSOKVHIYFVPAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClNO3S/c9-7-2-1-6(14-7)5-10-8(12)13-4-3-11/h1-2,11H,3-5H2,(H,10,12).
What are the key properties of 2-hydroxyethyl N-[(5-chlorothiophen-2-yl)methyl]carbamate?
2-hydroxyethyl N-[(5-chlorothiophen-2-yl)methyl]carbamate has a molecular weight of 235.69 g/mol, XLogP of 1.62, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl N-[(5-chlorothiophen-2-yl)methyl]carbamate is sourced from PubChem (CID 79348989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).