C11H14O — CID 13352001
tricyclo[6.3.0.01,5]undec-7-en-6-one (PubChem CID 13352001) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is tricyclo[6.3.0.01,5]undec-7-en-6-one.
| Compound Name | tricyclo[6.3.0.01,5]undec-7-en-6-one |
|---|---|
| PubChem CID | 13352001 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | tricyclo[6.3.0.01,5]undec-7-en-6-one |
| SMILES | O=C1C=C2CCCC23CCCC13 |
| InChI | InChI=1S/C11H14O/c12-10-7-8-3-1-5-11(8)6-2-4-9(10)11/h7,9H,1-6H2 |
| InChIKey | GYQPSGSXUNSBKE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |