C13H16O2 — CID 72760643
tricyclo[6.4.1.01,5]tridec-5-ene-7,13-dione (PubChem CID 72760643) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is tricyclo[6.4.1.01,5]tridec-5-ene-7,13-dione.
| Compound Name | tricyclo[6.4.1.01,5]tridec-5-ene-7,13-dione |
|---|---|
| PubChem CID | 72760643 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | tricyclo[6.4.1.01,5]tridec-5-ene-7,13-dione |
| SMILES | O=C1C=C2CCCC23CCCCC1C3=O |
| InChI | InChI=1S/C13H16O2/c14-11-8-9-4-3-7-13(9)6-2-1-5-10(11)12(13)15/h8,10H,1-7H2 |
| InChIKey | BZPOUMLWPVWMEM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|