About tricyclo[6.4.1.01,5]tridec-5-ene-7,13-dione
tricyclo[6.4.1.01,5]tridec-5-ene-7,13-dione (PubChem CID 72760643) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is tricyclo[6.4.1.01,5]tridec-5-ene-7,13-dione.
Molecular Properties
| Compound Name | tricyclo[6.4.1.01,5]tridec-5-ene-7,13-dione |
| PubChem CID | 72760643 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | tricyclo[6.4.1.01,5]tridec-5-ene-7,13-dione |
| SMILES | O=C1C=C2CCCC23CCCCC1C3=O |
| InChI | InChI=1S/C13H16O2/c14-11-8-9-4-3-7-13(9)6-2-1-5-10(11)12(13)15/h8,10H,1-7H2 |
| InChIKey | BZPOUMLWPVWMEM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze tricyclo[6.4.1.01,5]tridec-5-ene-7,13-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[6.4.1.01,5]tridec-5-ene-7,13-dione?
The IUPAC name of tricyclo[6.4.1.01,5]tridec-5-ene-7,13-dione (CID 72760643) is tricyclo[6.4.1.01,5]tridec-5-ene-7,13-dione.
What is the SMILES notation for tricyclo[6.4.1.01,5]tridec-5-ene-7,13-dione?
The canonical SMILES for tricyclo[6.4.1.01,5]tridec-5-ene-7,13-dione is O=C1C=C2CCCC23CCCCC1C3=O.
What is the InChIKey of tricyclo[6.4.1.01,5]tridec-5-ene-7,13-dione?
The InChIKey is BZPOUMLWPVWMEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2/c14-11-8-9-4-3-7-13(9)6-2-1-5-10(11)12(13)15/h8,10H,1-7H2.
What are the key properties of tricyclo[6.4.1.01,5]tridec-5-ene-7,13-dione?
tricyclo[6.4.1.01,5]tridec-5-ene-7,13-dione has a molecular weight of 204.27 g/mol, XLogP of 2.43, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[6.4.1.01,5]tridec-5-ene-7,13-dione is sourced from PubChem (CID 72760643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).