C13H11N3OS — CID 13352866
6-benzyl-4-methylsulfanyl-2-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 13352866) has the molecular formula C13H11N3OS and a molecular weight of 257.32 g/mol. Its IUPAC name is 6-benzyl-4-methylsulfanyl-2-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 6-benzyl-4-methylsulfanyl-2-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 13352866 |
| Molecular Formula | C13H11N3OS |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 6-benzyl-4-methylsulfanyl-2-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(=O)[nH]c(Cc2ccccc2)c1C#N |
| InChI | InChI=1S/C13H11N3OS/c1-18-12-10(8-14)11(15-13(17)16-12)7-9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,15,16,17) |
| InChIKey | LKQBTSIDILWXAC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |