C16H18N4OS — CID 139229665
2-[4-(diethylamino)phenyl]-4-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 139229665) has the molecular formula C16H18N4OS and a molecular weight of 314.41 g/mol. Its IUPAC name is 2-[4-(diethylamino)phenyl]-4-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[4-(diethylamino)phenyl]-4-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 139229665 |
| Molecular Formula | C16H18N4OS |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-[4-(diethylamino)phenyl]-4-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CCN(CC)c1ccc(-c2nc(SC)c(C#N)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C16H18N4OS/c1-4-20(5-2)12-8-6-11(7-9-12)14-18-15(21)13(10-17)16(19-14)22-3/h6-9H,4-5H2,1-3H3,(H,18,19,21) |
| InChIKey | KBXGDSGCDUASEM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |