C16H16Cl2N4OS — CID 168587471
4-[4-[bis(2-chloroethyl)amino]phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168587471) has the molecular formula C16H16Cl2N4OS and a molecular weight of 383.30 g/mol. Its IUPAC name is 4-[4-[bis(2-chloroethyl)amino]phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-[4-[bis(2-chloroethyl)amino]phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168587471 |
| Molecular Formula | C16H16Cl2N4OS |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 4-[4-[bis(2-chloroethyl)amino]phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(-c2ccc(N(CCCl)CCCl)cc2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C16H16Cl2N4OS/c1-24-16-20-14(13(10-19)15(23)21-16)11-2-4-12(5-3-11)22(8-6-17)9-7-18/h2-5H,6-9H2,1H3,(H,20,21,23) |
| InChIKey | ORGFYNJQXVBHKH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|