C18H18N4O2S — CID 1335320
1-(4-ethoxyphenyl)-3-[5-(3-methylphenyl)-1,3,4-thiadiazol-2-yl]urea (PubChem CID 1335320) has the molecular formula C18H18N4O2S and a molecular weight of 354.44 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3-[5-(3-methylphenyl)-1,3,4-thiadiazol-2-yl]urea.
| Compound Name | 1-(4-ethoxyphenyl)-3-[5-(3-methylphenyl)-1,3,4-thiadiazol-2-yl]urea |
|---|---|
| PubChem CID | 1335320 |
| Molecular Formula | C18H18N4O2S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3-[5-(3-methylphenyl)-1,3,4-thiadiazol-2-yl]urea |
| SMILES | CCOc1ccc(NC(=O)Nc2nnc(-c3cccc(C)c3)s2)cc1 |
| InChI | InChI=1S/C18H18N4O2S/c1-3-24-15-9-7-14(8-10-15)19-17(23)20-18-22-21-16(25-18)13-6-4-5-12(2)11-13/h4-11H,3H2,1-2H3,(H2,19,20,22,23) |
| InChIKey | NMYGNAHSBRIEKE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |