C20H19N3O3S — CID 4146881
1-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-3-(4-ethoxyphenyl)urea (PubChem CID 4146881) has the molecular formula C20H19N3O3S and a molecular weight of 381.46 g/mol. Its IUPAC name is 1-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-3-(4-ethoxyphenyl)urea.
| Compound Name | 1-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-3-(4-ethoxyphenyl)urea |
|---|---|
| PubChem CID | 4146881 |
| Molecular Formula | C20H19N3O3S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 1-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-3-(4-ethoxyphenyl)urea |
| SMILES | CCOc1ccc(NC(=O)Nc2nc(-c3ccccc3)c(C(C)=O)s2)cc1 |
| InChI | InChI=1S/C20H19N3O3S/c1-3-26-16-11-9-15(10-12-16)21-19(25)23-20-22-17(18(27-20)13(2)24)14-7-5-4-6-8-14/h4-12H,3H2,1-2H3,(H2,21,22,23,25) |
| InChIKey | XPBDUUCCBXIBCQ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |