C23H20N2O2 — CID 13353740
(5S,6R)-1-methyl-3,5,6-triphenyl-1,3-diazinane-2,4-dione (PubChem CID 13353740) has the molecular formula C23H20N2O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is (5S,6R)-1-methyl-3,5,6-triphenyl-1,3-diazinane-2,4-dione.
| Compound Name | (5S,6R)-1-methyl-3,5,6-triphenyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 13353740 |
| Molecular Formula | C23H20N2O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (5S,6R)-1-methyl-3,5,6-triphenyl-1,3-diazinane-2,4-dione |
| SMILES | CN1C(=O)N(c2ccccc2)C(=O)[C@@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C23H20N2O2/c1-24-21(18-13-7-3-8-14-18)20(17-11-5-2-6-12-17)22(26)25(23(24)27)19-15-9-4-10-16-19/h2-16,20-21H,1H3/t20-,21-/m0/s1 |
| InChIKey | DRXIDXOXCBSPMC-SFTDATJTSA-N |
| XLogP | 4.61 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |