C13H22OSi — CID 13360372
trimethyl-[(3R)-6-methyl-3-prop-1-en-2-ylcyclohexa-1,5-dien-1-yl]oxysilane (PubChem CID 13360372) has the molecular formula C13H22OSi and a molecular weight of 222.40 g/mol. Its IUPAC name is trimethyl-[(3R)-6-methyl-3-prop-1-en-2-ylcyclohexa-1,5-dien-1-yl]oxysilane.
| Compound Name | trimethyl-[(3R)-6-methyl-3-prop-1-en-2-ylcyclohexa-1,5-dien-1-yl]oxysilane |
|---|---|
| PubChem CID | 13360372 |
| Molecular Formula | C13H22OSi |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | trimethyl-[(3R)-6-methyl-3-prop-1-en-2-ylcyclohexa-1,5-dien-1-yl]oxysilane |
| SMILES | C=C(C)[C@H]1C=C(O[Si](C)(C)C)C(C)=CC1 |
| InChI | InChI=1S/C13H22OSi/c1-10(2)12-8-7-11(3)13(9-12)14-15(4,5)6/h7,9,12H,1,8H2,2-6H3/t12-/m1/s1 |
| InChIKey | JDANSBUFJJUXTK-GFCCVEGCSA-N |
| XLogP | 4.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|