C9H14N2O2 — CID 13366348
4-pentyl-1H-pyrazine-2,3-dione (PubChem CID 13366348) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 4-pentyl-1H-pyrazine-2,3-dione.
| Compound Name | 4-pentyl-1H-pyrazine-2,3-dione |
|---|---|
| PubChem CID | 13366348 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 4-pentyl-1H-pyrazine-2,3-dione |
| SMILES | CCCCCn1cc[nH]c(=O)c1=O |
| InChI | InChI=1S/C9H14N2O2/c1-2-3-4-6-11-7-5-10-8(12)9(11)13/h5,7H,2-4,6H2,1H3,(H,10,12) |
| InChIKey | OPUZQYPDCJXBAJ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|