About methyl 4-[(2S,3S)-1-(3-chlorophenyl)-3-(2-methylphenoxy)-4-oxoazetidin-2-yl]benzoate
methyl 4-[(2S,3S)-1-(3-chlorophenyl)-3-(2-methylphenoxy)-4-oxoazetidin-2-yl]benzoate (PubChem CID 1336845) has the molecular formula C24H20ClNO4
and a molecular weight of 421.88 g/mol. Its IUPAC name is methyl 4-[(2S,3S)-1-(3-chlorophenyl)-3-(2-methylphenoxy)-4-oxoazetidin-2-yl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[(2S,3S)-1-(3-chlorophenyl)-3-(2-methylphenoxy)-4-oxoazetidin-2-yl]benzoate |
| PubChem CID | 1336845 |
| Molecular Formula | C24H20ClNO4 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | methyl 4-[(2S,3S)-1-(3-chlorophenyl)-3-(2-methylphenoxy)-4-oxoazetidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2[C@H](Oc3ccccc3C)C(=O)N2c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C24H20ClNO4/c1-15-6-3-4-9-20(15)30-22-21(16-10-12-17(13-11-16)24(28)29-2)26(23(22)27)19-8-5-7-18(25)14-19/h3-14,21-22H,1-2H3/t21-,22-/m0/s1 |
| InChIKey | CUHXISPXCZCHQW-VXKWHMMOSA-N |
| XLogP | 4.97 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-[(2S,3S)-1-(3-chlorophenyl)-3-(2-methylphenoxy)-4-oxoazetidin-2-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(2S,3S)-1-(3-chlorophenyl)-3-(2-methylphenoxy)-4-oxoazetidin-2-yl]benzoate?
The IUPAC name of methyl 4-[(2S,3S)-1-(3-chlorophenyl)-3-(2-methylphenoxy)-4-oxoazetidin-2-yl]benzoate (CID 1336845) is methyl 4-[(2S,3S)-1-(3-chlorophenyl)-3-(2-methylphenoxy)-4-oxoazetidin-2-yl]benzoate.
What is the SMILES notation for methyl 4-[(2S,3S)-1-(3-chlorophenyl)-3-(2-methylphenoxy)-4-oxoazetidin-2-yl]benzoate?
The canonical SMILES for methyl 4-[(2S,3S)-1-(3-chlorophenyl)-3-(2-methylphenoxy)-4-oxoazetidin-2-yl]benzoate is COC(=O)c1ccc([C@H]2[C@H](Oc3ccccc3C)C(=O)N2c2cccc(Cl)c2)cc1.
What is the InChIKey of methyl 4-[(2S,3S)-1-(3-chlorophenyl)-3-(2-methylphenoxy)-4-oxoazetidin-2-yl]benzoate?
The InChIKey is CUHXISPXCZCHQW-VXKWHMMOSA-N. The full InChI is InChI=1S/C24H20ClNO4/c1-15-6-3-4-9-20(15)30-22-21(16-10-12-17(13-11-16)24(28)29-2)26(23(22)27)19-8-5-7-18(25)14-19/h3-14,21-22H,1-2H3/t21-,22-/m0/s1.
What are the key properties of methyl 4-[(2S,3S)-1-(3-chlorophenyl)-3-(2-methylphenoxy)-4-oxoazetidin-2-yl]benzoate?
methyl 4-[(2S,3S)-1-(3-chlorophenyl)-3-(2-methylphenoxy)-4-oxoazetidin-2-yl]benzoate has a molecular weight of 421.88 g/mol, XLogP of 4.97, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(2S,3S)-1-(3-chlorophenyl)-3-(2-methylphenoxy)-4-oxoazetidin-2-yl]benzoate is sourced from PubChem (CID 1336845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).