C19H19NO6S — CID 13370424
benzyl 2-[2-(benzenesulfonyloxymethyl)-4-oxoazetidin-1-yl]acetate (PubChem CID 13370424) has the molecular formula C19H19NO6S and a molecular weight of 389.43 g/mol. Its IUPAC name is benzyl 2-[2-(benzenesulfonyloxymethyl)-4-oxoazetidin-1-yl]acetate.
| Compound Name | benzyl 2-[2-(benzenesulfonyloxymethyl)-4-oxoazetidin-1-yl]acetate |
|---|---|
| PubChem CID | 13370424 |
| Molecular Formula | C19H19NO6S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | benzyl 2-[2-(benzenesulfonyloxymethyl)-4-oxoazetidin-1-yl]acetate |
| SMILES | O=C(CN1C(=O)CC1COS(=O)(=O)c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C19H19NO6S/c21-18-11-16(14-26-27(23,24)17-9-5-2-6-10-17)20(18)12-19(22)25-13-15-7-3-1-4-8-15/h1-10,16H,11-14H2 |
| InChIKey | HWWYIEUQNIQKHH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|