C29H29NO4 — CID 13370642
7-[3-(cyclopentylamino)-2-hydroxypropoxy]-2,3-diphenylchromen-4-one (PubChem CID 13370642) has the molecular formula C29H29NO4 and a molecular weight of 455.55 g/mol. Its IUPAC name is 7-[3-(cyclopentylamino)-2-hydroxypropoxy]-2,3-diphenylchromen-4-one.
| Compound Name | 7-[3-(cyclopentylamino)-2-hydroxypropoxy]-2,3-diphenylchromen-4-one |
|---|---|
| PubChem CID | 13370642 |
| Molecular Formula | C29H29NO4 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 7-[3-(cyclopentylamino)-2-hydroxypropoxy]-2,3-diphenylchromen-4-one |
| SMILES | O=c1c(-c2ccccc2)c(-c2ccccc2)oc2cc(OCC(O)CNC3CCCC3)ccc12 |
| InChI | InChI=1S/C29H29NO4/c31-23(18-30-22-13-7-8-14-22)19-33-24-15-16-25-26(17-24)34-29(21-11-5-2-6-12-21)27(28(25)32)20-9-3-1-4-10-20/h1-6,9-12,15-17,22-23,30-31H,7-8,13-14,18-19H2 |
| InChIKey | MSSKINBKRSPCJX-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |