C21H17F7N2O — CID 13371344
2-[5-[4-(dimethylamino)phenyl]-4-(4-fluorophenyl)-1H-pyrrol-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 13371344) has the molecular formula C21H17F7N2O and a molecular weight of 446.37 g/mol. Its IUPAC name is 2-[5-[4-(dimethylamino)phenyl]-4-(4-fluorophenyl)-1H-pyrrol-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[5-[4-(dimethylamino)phenyl]-4-(4-fluorophenyl)-1H-pyrrol-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 13371344 |
| Molecular Formula | C21H17F7N2O |
| Molecular Weight | 446.37 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 2-[5-[4-(dimethylamino)phenyl]-4-(4-fluorophenyl)-1H-pyrrol-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CN(C)c1ccc(-c2[nH]c(C(O)(C(F)(F)F)C(F)(F)F)cc2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H17F7N2O/c1-30(2)15-9-5-13(6-10-15)18-16(12-3-7-14(22)8-4-12)11-17(29-18)19(31,20(23,24)25)21(26,27)28/h3-11,29,31H,1-2H3 |
| InChIKey | KKWWQAPOJLROKY-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.37 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|