C13H12BrFN2O2 — CID 13373245
4-bromo-2-ethyl-5-[(4-fluorophenyl)methoxy]pyridazin-3-one (PubChem CID 13373245) has the molecular formula C13H12BrFN2O2 and a molecular weight of 327.15 g/mol. Its IUPAC name is 4-bromo-2-ethyl-5-[(4-fluorophenyl)methoxy]pyridazin-3-one.
| Compound Name | 4-bromo-2-ethyl-5-[(4-fluorophenyl)methoxy]pyridazin-3-one |
|---|---|
| PubChem CID | 13373245 |
| Molecular Formula | C13H12BrFN2O2 |
| Molecular Weight | 327.15 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 4-bromo-2-ethyl-5-[(4-fluorophenyl)methoxy]pyridazin-3-one |
| SMILES | CCn1ncc(OCc2ccc(F)cc2)c(Br)c1=O |
| InChI | InChI=1S/C13H12BrFN2O2/c1-2-17-13(18)12(14)11(7-16-17)19-8-9-3-5-10(15)6-4-9/h3-7H,2,8H2,1H3 |
| InChIKey | WVPYUQBFMXZPDS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.15 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |