C28H35N3O7S — CID 13375143
methyl 2-[[(3R)-5-(2-ethoxy-2-oxoethyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]amino]-6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 13375143) has the molecular formula C28H35N3O7S and a molecular weight of 557.67 g/mol. Its IUPAC name is methyl 2-[[(3R)-5-(2-ethoxy-2-oxoethyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]amino]-6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | methyl 2-[[(3R)-5-(2-ethoxy-2-oxoethyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 13375143 |
| Molecular Formula | C28H35N3O7S |
| Molecular Weight | 557.67 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | methyl 2-[[(3R)-5-(2-ethoxy-2-oxoethyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | CCOC(=O)CN1C(=O)[C@@H](NC(CCCCNC(=O)OCc2ccccc2)C(=O)OC)CSc2ccccc21 |
| InChI | InChI=1S/C28H35N3O7S/c1-3-37-25(32)17-31-23-14-7-8-15-24(23)39-19-22(26(31)33)30-21(27(34)36-2)13-9-10-16-29-28(35)38-18-20-11-5-4-6-12-20/h4-8,11-12,14-15,21-22,30H,3,9-10,13,16-19H2,1-2H3,(H,29,35)/t21?,22-/m0/s1 |
| InChIKey | WGPCTNTZAWLKCR-KEKNWZKVSA-N |
| XLogP | 3.28 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.67 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|