C29H37N3O7S — CID 70416341
ethyl (2R)-2-[[5-(2-ethoxy-2-oxoethyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]amino]-6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 70416341) has the molecular formula C29H37N3O7S and a molecular weight of 571.70 g/mol. Its IUPAC name is ethyl (2R)-2-[[5-(2-ethoxy-2-oxoethyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]amino]-6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | ethyl (2R)-2-[[5-(2-ethoxy-2-oxoethyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 70416341 |
| Molecular Formula | C29H37N3O7S |
| Molecular Weight | 571.70 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | ethyl (2R)-2-[[5-(2-ethoxy-2-oxoethyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | CCOC(=O)CN1C(=O)C(N[C@H](CCCCNC(=O)OCc2ccccc2)C(=O)OCC)CSc2ccccc21 |
| InChI | InChI=1S/C29H37N3O7S/c1-3-37-26(33)18-32-24-15-8-9-16-25(24)40-20-23(27(32)34)31-22(28(35)38-4-2)14-10-11-17-30-29(36)39-19-21-12-6-5-7-13-21/h5-9,12-13,15-16,22-23,31H,3-4,10-11,14,17-20H2,1-2H3,(H,30,36)/t22-,23?/m1/s1 |
| InChIKey | OAOIWXDYPTXIID-WTQRLHSKSA-N |
| XLogP | 3.67 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.70 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|