C6H8O3 — CID 13380493
2,6-dimethyl-1,3-dioxin-4-one (PubChem CID 13380493) has the molecular formula C6H8O3 and a molecular weight of 128.13 g/mol. Its IUPAC name is 2,6-dimethyl-1,3-dioxin-4-one.
| Compound Name | 2,6-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 13380493 |
| Molecular Formula | C6H8O3 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.05 |
| IUPAC Name | 2,6-dimethyl-1,3-dioxin-4-one |
| SMILES | CC1=CC(=O)OC(C)O1 |
| InChI | InChI=1S/C6H8O3/c1-4-3-6(7)9-5(2)8-4/h3,5H,1-2H3 |
| InChIKey | YLGPQIGCXTTYTF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |