C16H15N3S — CID 13380651
5-benzyl-N-(2-methylphenyl)-1,3,4-thiadiazol-2-amine (PubChem CID 13380651) has the molecular formula C16H15N3S and a molecular weight of 281.38 g/mol. Its IUPAC name is 5-benzyl-N-(2-methylphenyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-benzyl-N-(2-methylphenyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 13380651 |
| Molecular Formula | C16H15N3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 5-benzyl-N-(2-methylphenyl)-1,3,4-thiadiazol-2-amine |
| SMILES | Cc1ccccc1Nc1nnc(Cc2ccccc2)s1 |
| InChI | InChI=1S/C16H15N3S/c1-12-7-5-6-10-14(12)17-16-19-18-15(20-16)11-13-8-3-2-4-9-13/h2-10H,11H2,1H3,(H,17,19) |
| InChIKey | YGWFQJMLAKXQMB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |