C14H10N2O3 — CID 13386488
7-methyl-4-oxopyrimido[2,1-a]isoquinoline-3-carboxylic acid (PubChem CID 13386488) has the molecular formula C14H10N2O3 and a molecular weight of 254.25 g/mol. Its IUPAC name is 7-methyl-4-oxopyrimido[2,1-a]isoquinoline-3-carboxylic acid.
| Compound Name | 7-methyl-4-oxopyrimido[2,1-a]isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 13386488 |
| Molecular Formula | C14H10N2O3 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 7-methyl-4-oxopyrimido[2,1-a]isoquinoline-3-carboxylic acid |
| SMILES | Cc1cn2c(=O)c(C(=O)O)cnc2c2ccccc12 |
| InChI | InChI=1S/C14H10N2O3/c1-8-7-16-12(10-5-3-2-4-9(8)10)15-6-11(13(16)17)14(18)19/h2-7H,1H3,(H,18,19) |
| InChIKey | FSAYVFCRNHULNB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|