C25H52OSiSn — CID 13387952
[(E)-1-cyclopropyl-3-methyl-6-tributylstannylhex-5-en-3-yl]oxy-trimethylsilane (PubChem CID 13387952) has the molecular formula C25H52OSiSn and a molecular weight of 515.49 g/mol. Its IUPAC name is [(E)-1-cyclopropyl-3-methyl-6-tributylstannylhex-5-en-3-yl]oxy-trimethylsilane.
| Compound Name | [(E)-1-cyclopropyl-3-methyl-6-tributylstannylhex-5-en-3-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 13387952 |
| Molecular Formula | C25H52OSiSn |
| Molecular Weight | 515.49 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | [(E)-1-cyclopropyl-3-methyl-6-tributylstannylhex-5-en-3-yl]oxy-trimethylsilane |
| SMILES | CCCC[Sn](/C=C/CC(C)(CCC1CC1)O[Si](C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C13H25OSi.3C4H9.Sn/c1-6-10-13(2,14-15(3,4)5)11-9-12-7-8-12;3*1-3-4-2;/h1,6,12H,7-11H2,2-5H3;3*1,3-4H2,2H3; |
| InChIKey | BTOHNZKLRPKQSY-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.49 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|