C15H19NO4 — CID 13388225
2-(oxiran-2-ylmethoxy)-N,N-bis(oxiran-2-ylmethyl)aniline (PubChem CID 13388225) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethoxy)-N,N-bis(oxiran-2-ylmethyl)aniline.
| Compound Name | 2-(oxiran-2-ylmethoxy)-N,N-bis(oxiran-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 13388225 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 2-(oxiran-2-ylmethoxy)-N,N-bis(oxiran-2-ylmethyl)aniline |
| SMILES | c1ccc(N(CC2CO2)CC2CO2)c(OCC2CO2)c1 |
| InChI | InChI=1S/C15H19NO4/c1-2-4-15(20-10-13-9-19-13)14(3-1)16(5-11-7-17-11)6-12-8-18-12/h1-4,11-13H,5-10H2 |
| InChIKey | JOYONZOLHMLNGF-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 50.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|