C6H4F4N2OS — CID 13391606
6-fluoro-4-methoxy-5-(trifluoromethyl)-1H-pyrimidine-2-thione (PubChem CID 13391606) has the molecular formula C6H4F4N2OS and a molecular weight of 228.17 g/mol. Its IUPAC name is 6-fluoro-4-methoxy-5-(trifluoromethyl)-1H-pyrimidine-2-thione.
| Compound Name | 6-fluoro-4-methoxy-5-(trifluoromethyl)-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 13391606 |
| Molecular Formula | C6H4F4N2OS |
| Molecular Weight | 228.17 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | 6-fluoro-4-methoxy-5-(trifluoromethyl)-1H-pyrimidine-2-thione |
| SMILES | COc1nc(=S)[nH]c(F)c1C(F)(F)F |
| InChI | InChI=1S/C6H4F4N2OS/c1-13-4-2(6(8,9)10)3(7)11-5(14)12-4/h1H3,(H,11,12,14) |
| InChIKey | LBASSSYVOKBWKD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.17 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|