C21H18N2O5S — CID 1339367
2-[[4-[benzenesulfonyl(methyl)amino]benzoyl]amino]benzoic acid (PubChem CID 1339367) has the molecular formula C21H18N2O5S and a molecular weight of 410.45 g/mol. Its IUPAC name is 2-[[4-[benzenesulfonyl(methyl)amino]benzoyl]amino]benzoic acid.
| Compound Name | 2-[[4-[benzenesulfonyl(methyl)amino]benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 1339367 |
| Molecular Formula | C21H18N2O5S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 2-[[4-[benzenesulfonyl(methyl)amino]benzoyl]amino]benzoic acid |
| SMILES | CN(c1ccc(C(=O)Nc2ccccc2C(=O)O)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H18N2O5S/c1-23(29(27,28)17-7-3-2-4-8-17)16-13-11-15(12-14-16)20(24)22-19-10-6-5-9-18(19)21(25)26/h2-14H,1H3,(H,22,24)(H,25,26) |
| InChIKey | OQYVMEROXTYKDW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |