C26H23N3O5S — CID 1302890
2-[[4-[benzenesulfonyl(methyl)amino]benzoyl]amino]-N-(furan-2-ylmethyl)benzamide (PubChem CID 1302890) has the molecular formula C26H23N3O5S and a molecular weight of 489.55 g/mol. Its IUPAC name is 2-[[4-[benzenesulfonyl(methyl)amino]benzoyl]amino]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 2-[[4-[benzenesulfonyl(methyl)amino]benzoyl]amino]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 1302890 |
| Molecular Formula | C26H23N3O5S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 2-[[4-[benzenesulfonyl(methyl)amino]benzoyl]amino]-N-(furan-2-ylmethyl)benzamide |
| SMILES | CN(c1ccc(C(=O)Nc2ccccc2C(=O)NCc2ccco2)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H23N3O5S/c1-29(35(32,33)22-9-3-2-4-10-22)20-15-13-19(14-16-20)25(30)28-24-12-6-5-11-23(24)26(31)27-18-21-8-7-17-34-21/h2-17H,18H2,1H3,(H,27,31)(H,28,30) |
| InChIKey | IAHPFXZXPPTHDU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |