C18H17N3O4S — CID 50795472
5-[benzenesulfonyl(methyl)amino]-N-(furan-2-ylmethyl)pyridine-3-carboxamide (PubChem CID 50795472) has the molecular formula C18H17N3O4S and a molecular weight of 371.42 g/mol. Its IUPAC name is 5-[benzenesulfonyl(methyl)amino]-N-(furan-2-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 5-[benzenesulfonyl(methyl)amino]-N-(furan-2-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 50795472 |
| Molecular Formula | C18H17N3O4S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 5-[benzenesulfonyl(methyl)amino]-N-(furan-2-ylmethyl)pyridine-3-carboxamide |
| SMILES | CN(c1cncc(C(=O)NCc2ccco2)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H17N3O4S/c1-21(26(23,24)17-7-3-2-4-8-17)15-10-14(11-19-12-15)18(22)20-13-16-6-5-9-25-16/h2-12H,13H2,1H3,(H,20,22) |
| InChIKey | RMCBUFXHLIJBRF-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |