C25H20FN3O5S — CID 34647496
2-[[4-[(4-fluorophenyl)sulfonylamino]benzoyl]amino]-N-(furan-2-ylmethyl)benzamide (PubChem CID 34647496) has the molecular formula C25H20FN3O5S and a molecular weight of 493.52 g/mol. Its IUPAC name is 2-[[4-[(4-fluorophenyl)sulfonylamino]benzoyl]amino]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 2-[[4-[(4-fluorophenyl)sulfonylamino]benzoyl]amino]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 34647496 |
| Molecular Formula | C25H20FN3O5S |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | 2-[[4-[(4-fluorophenyl)sulfonylamino]benzoyl]amino]-N-(furan-2-ylmethyl)benzamide |
| SMILES | O=C(Nc1ccccc1C(=O)NCc1ccco1)c1ccc(NS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H20FN3O5S/c26-18-9-13-21(14-10-18)35(32,33)29-19-11-7-17(8-12-19)24(30)28-23-6-2-1-5-22(23)25(31)27-16-20-4-3-15-34-20/h1-15,29H,16H2,(H,27,31)(H,28,30) |
| InChIKey | KDHYXFISRBZNDO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |