C19H15N2O6S- — CID 8603467
4-[[2-(furan-2-ylmethylcarbamoyl)phenyl]sulfamoyl]benzoate (PubChem CID 8603467) has the molecular formula C19H15N2O6S- and a molecular weight of 399.40 g/mol. Its IUPAC name is 4-[[2-(furan-2-ylmethylcarbamoyl)phenyl]sulfamoyl]benzoate.
| Compound Name | 4-[[2-(furan-2-ylmethylcarbamoyl)phenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 8603467 |
| Molecular Formula | C19H15N2O6S- |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 4-[[2-(furan-2-ylmethylcarbamoyl)phenyl]sulfamoyl]benzoate |
| SMILES | O=C([O-])c1ccc(S(=O)(=O)Nc2ccccc2C(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C19H16N2O6S/c22-18(20-12-14-4-3-11-27-14)16-5-1-2-6-17(16)21-28(25,26)15-9-7-13(8-10-15)19(23)24/h1-11,21H,12H2,(H,20,22)(H,23,24)/p-1 |
| InChIKey | GOUZQINHTHMKOU-UHFFFAOYSA-M |
| XLogP | 1.37 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |