C19H17N3O7S — CID 26982526
N-(furan-2-ylmethyl)-2-[(4-methoxy-3-nitrophenyl)sulfonylamino]benzamide (PubChem CID 26982526) has the molecular formula C19H17N3O7S and a molecular weight of 431.43 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[(4-methoxy-3-nitrophenyl)sulfonylamino]benzamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[(4-methoxy-3-nitrophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 26982526 |
| Molecular Formula | C19H17N3O7S |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[(4-methoxy-3-nitrophenyl)sulfonylamino]benzamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccccc2C(=O)NCc2ccco2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H17N3O7S/c1-28-18-9-8-14(11-17(18)22(24)25)30(26,27)21-16-7-3-2-6-15(16)19(23)20-12-13-5-4-10-29-13/h2-11,21H,12H2,1H3,(H,20,23) |
| InChIKey | UBOUMNPKAKPUIB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 140.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|