C14H24 — CID 13396196
1,1,2,2-tetramethyl-3-(2,2,3,3-tetramethylcyclopropylidene)cyclopropane (PubChem CID 13396196) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is 1,1,2,2-tetramethyl-3-(2,2,3,3-tetramethylcyclopropylidene)cyclopropane.
| Compound Name | 1,1,2,2-tetramethyl-3-(2,2,3,3-tetramethylcyclopropylidene)cyclopropane |
|---|---|
| PubChem CID | 13396196 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 1,1,2,2-tetramethyl-3-(2,2,3,3-tetramethylcyclopropylidene)cyclopropane |
| SMILES | CC1(C)C(=C2C(C)(C)C2(C)C)C1(C)C |
| InChI | InChI=1S/C14H24/c1-11(2)9(12(11,3)4)10-13(5,6)14(10,7)8/h1-8H3 |
| InChIKey | MERNIJGKGAJWDB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|