C18H28 — CID 13128957
1-methyl-1-[1,2,2-tris(1-methylcyclopropyl)ethenyl]cyclopropane (PubChem CID 13128957) has the molecular formula C18H28 and a molecular weight of 244.42 g/mol. Its IUPAC name is 1-methyl-1-[1,2,2-tris(1-methylcyclopropyl)ethenyl]cyclopropane.
| Compound Name | 1-methyl-1-[1,2,2-tris(1-methylcyclopropyl)ethenyl]cyclopropane |
|---|---|
| PubChem CID | 13128957 |
| Molecular Formula | C18H28 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 1-methyl-1-[1,2,2-tris(1-methylcyclopropyl)ethenyl]cyclopropane |
| SMILES | CC1(C(=C(C2(C)CC2)C2(C)CC2)C2(C)CC2)CC1 |
| InChI | InChI=1S/C18H28/c1-15(5-6-15)13(16(2)7-8-16)14(17(3)9-10-17)18(4)11-12-18/h5-12H2,1-4H3 |
| InChIKey | PNMFGCAUVMKQDW-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|