C30H32 — CID 134889487
(4S,5S,6S,7S,8S,9E)-9-[(4S,5S,6S,7S,8S)-hexaspiro[2.0.0.0.0.0.28.17.16.15.14.13]pentadecan-9-ylidene]hexaspiro[2.0.0.0.0.0.28.17.16.15.14.13]pentadecane (PubChem CID 134889487) has the molecular formula C30H32 and a molecular weight of 392.59 g/mol. Its IUPAC name is (4S,5S,6S,7S,8S,9E)-9-[(4S,5S,6S,7S,8S)-hexaspiro[2.0.0.0.0.0.28.17.16.15.14.13]pentadecan-9-ylidene]hexaspiro[2.0.0.0.0.0.28.17.16.15.14.13]pentadecane.
| Compound Name | (4S,5S,6S,7S,8S,9E)-9-[(4S,5S,6S,7S,8S)-hexaspiro[2.0.0.0.0.0.28.17.16.15.14.13]pentadecan-9-ylidene]hexaspiro[2.0.0.0.0.0.28.17.16.15.14.13]pentadecane |
|---|---|
| PubChem CID | 134889487 |
| Molecular Formula | C30H32 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | (4S,5S,6S,7S,8S,9E)-9-[(4S,5S,6S,7S,8S)-hexaspiro[2.0.0.0.0.0.28.17.16.15.14.13]pentadecan-9-ylidene]hexaspiro[2.0.0.0.0.0.28.17.16.15.14.13]pentadecane |
| SMILES | C1CC12C[C@]21C[C@]12C[C@]21C[C@]12C[C@]21C/C1=C1/C[C@]12C[C@]21C[C@]12C[C@]21C[C@]12CC21CC1 |
| InChI | InChI=1S/C30H32/c1-2-19(1)7-23(19)11-27(23)15-29(27)13-25(29)9-21(25)5-17(21)18-6-22(18)10-26(22)14-30(26)16-28(30)12-24(28)8-20(24)3-4-20/h1-16H2/b18-17+/t21-,22-,23-,24-,25-,26-,27-,28-,29-,30-/m0/s1 |
| InChIKey | VIZWDHGMQYRFEC-MFMLRJMISA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|