C24H32 — CID 46919073
(1S,4S,6S,7R,9R,12R,14R,15S)-17,18,19,20-tetramethylheptacyclo[10.4.2.24,9.01,15.04,6.07,9.012,14]icosa-17,19-diene (PubChem CID 46919073) has the molecular formula C24H32 and a molecular weight of 320.52 g/mol. Its IUPAC name is (1S,4S,6S,7R,9R,12R,14R,15S)-17,18,19,20-tetramethylheptacyclo[10.4.2.24,9.01,15.04,6.07,9.012,14]icosa-17,19-diene.
| Compound Name | (1S,4S,6S,7R,9R,12R,14R,15S)-17,18,19,20-tetramethylheptacyclo[10.4.2.24,9.01,15.04,6.07,9.012,14]icosa-17,19-diene |
|---|---|
| PubChem CID | 46919073 |
| Molecular Formula | C24H32 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | (1S,4S,6S,7R,9R,12R,14R,15S)-17,18,19,20-tetramethylheptacyclo[10.4.2.24,9.01,15.04,6.07,9.012,14]icosa-17,19-diene |
| SMILES | CC1=C(C)[C@]23CC[C@]45C[C@H]4[C@H]4C[C@@]4(CC[C@]14C[C@@H]4[C@@H]2C3)C(C)=C5C |
| InChI | InChI=1S/C24H32/c1-13-14(2)22-7-8-24-12-20(24)19-11-23(19,15(3)16(24)4)6-5-21(13)9-17(21)18(22)10-22/h17-20H,5-12H2,1-4H3/t17-,18+,19-,20+,21+,22-,23+,24- |
| InChIKey | PRBQTXJJMXEKLK-OUMJIQPGSA-N |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|