C23H40 — CID 134865182
trans-(1R,2R)-1-[[(1R,2S)-1,2-dimethyl-2-(3-methylbut-3-enyl)cyclopropyl]methyl]-1,2-dimethyl-2-[[(1R)-1,2,2-trimethylcyclopropyl]methyl]cyclopropane (PubChem CID 134865182) has the molecular formula C23H40 and a molecular weight of 316.57 g/mol. Its IUPAC name is trans-(1R,2R)-1-[[(1R,2S)-1,2-dimethyl-2-(3-methylbut-3-enyl)cyclopropyl]methyl]-1,2-dimethyl-2-[[(1R)-1,2,2-trimethylcyclopropyl]methyl]cyclopropane.
| Compound Name | trans-(1R,2R)-1-[[(1R,2S)-1,2-dimethyl-2-(3-methylbut-3-enyl)cyclopropyl]methyl]-1,2-dimethyl-2-[[(1R)-1,2,2-trimethylcyclopropyl]methyl]cyclopropane |
|---|---|
| PubChem CID | 134865182 |
| Molecular Formula | C23H40 |
| Molecular Weight | 316.57 g/mol |
| Exact Mass | 316.31 |
| IUPAC Name | trans-(1R,2R)-1-[[(1R,2S)-1,2-dimethyl-2-(3-methylbut-3-enyl)cyclopropyl]methyl]-1,2-dimethyl-2-[[(1R)-1,2,2-trimethylcyclopropyl]methyl]cyclopropane |
| SMILES | C=C(C)CC[C@@]1(C)C[C@]1(C)C[C@@]1(C)C[C@]1(C)C[C@@]1(C)CC1(C)C |
| InChI | InChI=1S/C23H40/c1-17(2)10-11-19(5)13-21(19,7)15-23(9)16-22(23,8)14-20(6)12-18(20,3)4/h1,10-16H2,2-9H3/t19-,20+,21+,22-,23-/m0/s1 |
| InChIKey | FUKOYLCVKZKXJO-NQQQLTFYSA-N |
| XLogP | 7.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.57 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|