C26H36 — CID 12706186
1,1,2,2,5,5,6,6-octamethyl-7,8-bis(3-methylbuta-1,2-dienylidene)dispiro[2.0.24.23]octane (PubChem CID 12706186) has the molecular formula C26H36 and a molecular weight of 348.57 g/mol. Its IUPAC name is 1,1,2,2,5,5,6,6-octamethyl-7,8-bis(3-methylbuta-1,2-dienylidene)dispiro[2.0.24.23]octane.
| Compound Name | 1,1,2,2,5,5,6,6-octamethyl-7,8-bis(3-methylbuta-1,2-dienylidene)dispiro[2.0.24.23]octane |
|---|---|
| PubChem CID | 12706186 |
| Molecular Formula | C26H36 |
| Molecular Weight | 348.57 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | 1,1,2,2,5,5,6,6-octamethyl-7,8-bis(3-methylbuta-1,2-dienylidene)dispiro[2.0.24.23]octane |
| SMILES | CC(C)=C=C=C1C(=C=C=C(C)C)C2(C(C)(C)C2(C)C)C12C(C)(C)C2(C)C |
| InChI | InChI=1S/C26H36/c1-17(2)13-15-19-20(16-14-18(3)4)26(23(9,10)24(26,11)12)25(19)21(5,6)22(25,7)8/h1-12H3 |
| InChIKey | KKNCOYOPUUSQQN-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.57 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |