C22H26O3 — CID 13396588
3-(4-cyclohexylphenyl)-3-hydroxy-3-(3-methylphenyl)propanoic acid (PubChem CID 13396588) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is 3-(4-cyclohexylphenyl)-3-hydroxy-3-(3-methylphenyl)propanoic acid.
| Compound Name | 3-(4-cyclohexylphenyl)-3-hydroxy-3-(3-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 13396588 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 3-(4-cyclohexylphenyl)-3-hydroxy-3-(3-methylphenyl)propanoic acid |
| SMILES | Cc1cccc(C(O)(CC(=O)O)c2ccc(C3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C22H26O3/c1-16-6-5-9-20(14-16)22(25,15-21(23)24)19-12-10-18(11-13-19)17-7-3-2-4-8-17/h5-6,9-14,17,25H,2-4,7-8,15H2,1H3,(H,23,24) |
| InChIKey | PHOZVLLKQZEJEU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |