C11H16O3 — CID 13396914
3-[2-(1,3-dioxolan-2-yl)ethyl]cyclohex-3-en-1-one (PubChem CID 13396914) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-[2-(1,3-dioxolan-2-yl)ethyl]cyclohex-3-en-1-one.
| Compound Name | 3-[2-(1,3-dioxolan-2-yl)ethyl]cyclohex-3-en-1-one |
|---|---|
| PubChem CID | 13396914 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 3-[2-(1,3-dioxolan-2-yl)ethyl]cyclohex-3-en-1-one |
| SMILES | O=C1CCC=C(CCC2OCCO2)C1 |
| InChI | InChI=1S/C11H16O3/c12-10-3-1-2-9(8-10)4-5-11-13-6-7-14-11/h2,11H,1,3-8H2 |
| InChIKey | YCZZVNYXTPDKPH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|