C12H20O3 — CID 131857971
(Z)-1-(1,3-dioxolan-2-yl)non-6-en-3-one (PubChem CID 131857971) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is (Z)-1-(1,3-dioxolan-2-yl)non-6-en-3-one.
| Compound Name | (Z)-1-(1,3-dioxolan-2-yl)non-6-en-3-one |
|---|---|
| PubChem CID | 131857971 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (Z)-1-(1,3-dioxolan-2-yl)non-6-en-3-one |
| SMILES | CC/C=C\CCC(=O)CCC1OCCO1 |
| InChI | InChI=1S/C12H20O3/c1-2-3-4-5-6-11(13)7-8-12-14-9-10-15-12/h3-4,12H,2,5-10H2,1H3/b4-3- |
| InChIKey | MAHWYFQELBZYDC-ARJAWSKDSA-N |
| XLogP | 2.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|