C15H26O3 — CID 72576194
11-(2-methyl-1,3-dioxolan-2-yl)undec-5-enal (PubChem CID 72576194) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is 11-(2-methyl-1,3-dioxolan-2-yl)undec-5-enal.
| Compound Name | 11-(2-methyl-1,3-dioxolan-2-yl)undec-5-enal |
|---|---|
| PubChem CID | 72576194 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 11-(2-methyl-1,3-dioxolan-2-yl)undec-5-enal |
| SMILES | CC1(CCCCCC=CCCCC=O)OCCO1 |
| InChI | InChI=1S/C15H26O3/c1-15(17-13-14-18-15)11-9-7-5-3-2-4-6-8-10-12-16/h2,4,12H,3,5-11,13-14H2,1H3 |
| InChIKey | JVHRVHFVYMZXSR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|