C16H28O3 — CID 143159035
(Z)-12-(2-methyl-1,3-dioxolan-2-yl)dodec-6-enal (PubChem CID 143159035) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is (Z)-12-(2-methyl-1,3-dioxolan-2-yl)dodec-6-enal.
| Compound Name | (Z)-12-(2-methyl-1,3-dioxolan-2-yl)dodec-6-enal |
|---|---|
| PubChem CID | 143159035 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | (Z)-12-(2-methyl-1,3-dioxolan-2-yl)dodec-6-enal |
| SMILES | CC1(CCCCC/C=C\CCCCC=O)OCCO1 |
| InChI | InChI=1S/C16H28O3/c1-16(18-14-15-19-16)12-10-8-6-4-2-3-5-7-9-11-13-17/h2-3,13H,4-12,14-15H2,1H3/b3-2- |
| InChIKey | VUQWCBXKRJYHQO-IHWYPQMZSA-N |
| XLogP | 4.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|