C24H44O4 — CID 582071
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl octadec-9-enoate (PubChem CID 582071) has the molecular formula C24H44O4 and a molecular weight of 396.61 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl octadec-9-enoate.
| Compound Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl octadec-9-enoate |
|---|---|
| PubChem CID | 582071 |
| Molecular Formula | C24H44O4 |
| Molecular Weight | 396.61 g/mol |
| Exact Mass | 396.32 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC1COC(C)(C)O1 |
| InChI | InChI=1S/C24H44O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(25)26-20-22-21-27-24(2,3)28-22/h11-12,22H,4-10,13-21H2,1-3H3 |
| InChIKey | LEEQPXMGHNSQNP-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.61 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|