C44H38N4O8 — CID 13397863
ethyl 3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-5-[2-[3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-2-ethoxycarbonyl-1H-indol-5-yl]ethyl]-1H-indole-2-carboxylate (PubChem CID 13397863) has the molecular formula C44H38N4O8 and a molecular weight of 750.81 g/mol. Its IUPAC name is ethyl 3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-5-[2-[3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-2-ethoxycarbonyl-1H-indol-5-yl]ethyl]-1H-indole-2-carboxylate.
| Compound Name | ethyl 3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-5-[2-[3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-2-ethoxycarbonyl-1H-indol-5-yl]ethyl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 13397863 |
| Molecular Formula | C44H38N4O8 |
| Molecular Weight | 750.81 g/mol |
| Exact Mass | 750.27 |
| IUPAC Name | ethyl 3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-5-[2-[3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-2-ethoxycarbonyl-1H-indol-5-yl]ethyl]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2ccc(CCc3ccc4[nH]c(C(=O)OCC)c(CCN5C(=O)c6ccccc6C5=O)c4c3)cc2c1CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C44H38N4O8/c1-3-55-43(53)37-27(19-21-47-39(49)29-9-5-6-10-30(29)40(47)50)33-23-25(15-17-35(33)45-37)13-14-26-16-18-36-34(24-26)28(38(46-36)44(54)56-4-2)20-22-48-41(51)31-11-7-8-12-32(31)42(48)52/h5-12,15-18,23-24,45-46H,3-4,13-14,19-22H2,1-2H3 |
| InChIKey | YBNZVVGBOIMKOU-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 158.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.81 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|