C23H19N3O4 — CID 46888203
methyl (1R,12S)-10-(5-methyl-1H-indole-2-carbonyl)-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-4-carboxylate (PubChem CID 46888203) has the molecular formula C23H19N3O4 and a molecular weight of 401.42 g/mol. Its IUPAC name is methyl (1R,12S)-10-(5-methyl-1H-indole-2-carbonyl)-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-4-carboxylate.
| Compound Name | methyl (1R,12S)-10-(5-methyl-1H-indole-2-carbonyl)-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-4-carboxylate |
|---|---|
| PubChem CID | 46888203 |
| Molecular Formula | C23H19N3O4 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | methyl (1R,12S)-10-(5-methyl-1H-indole-2-carbonyl)-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-4-carboxylate |
| SMILES | COC(=O)c1cc2c([nH]1)C(=O)C=C1N(C(=O)c3cc4cc(C)ccc4[nH]3)C[C@H]3C[C@]123 |
| InChI | InChI=1S/C23H19N3O4/c1-11-3-4-15-12(5-11)6-16(24-15)21(28)26-10-13-9-23(13)14-7-17(22(29)30-2)25-20(14)18(27)8-19(23)26/h3-8,13,24-25H,9-10H2,1-2H3/t13-,23-/m1/s1 |
| InChIKey | YZPAGPXWCLBKBA-JCQPUDPBSA-N |
| XLogP | 3.08 |
| TPSA | 95.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |